C24H25Cl2NOS — CID 143010826
2-[benzyl-[[(1S)-2-(2,6-dichlorophenyl)-1-phenylethyl]sulfanylmethyl]amino]ethanol (PubChem CID 143010826) has the molecular formula C24H25Cl2NOS and a molecular weight of 446.44 g/mol. Its IUPAC name is 2-[benzyl-[[(1S)-2-(2,6-dichlorophenyl)-1-phenylethyl]sulfanylmethyl]amino]ethanol.
| Compound Name | 2-[benzyl-[[(1S)-2-(2,6-dichlorophenyl)-1-phenylethyl]sulfanylmethyl]amino]ethanol |
|---|---|
| PubChem CID | 143010826 |
| Molecular Formula | C24H25Cl2NOS |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[benzyl-[[(1S)-2-(2,6-dichlorophenyl)-1-phenylethyl]sulfanylmethyl]amino]ethanol |
| SMILES | OCCN(CS[C@@H](Cc1c(Cl)cccc1Cl)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25Cl2NOS/c25-22-12-7-13-23(26)21(22)16-24(20-10-5-2-6-11-20)29-18-27(14-15-28)17-19-8-3-1-4-9-19/h1-13,24,28H,14-18H2/t24-/m0/s1 |
| InChIKey | QAWJDJGEWLFFHX-DEOSSOPVSA-N |
| XLogP | 6.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|