C12H26N4O — CID 143011244
1,4-dimethylpiperazine;N-piperidin-4-ylformamide (PubChem CID 143011244) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;N-piperidin-4-ylformamide.
| Compound Name | 1,4-dimethylpiperazine;N-piperidin-4-ylformamide |
|---|---|
| PubChem CID | 143011244 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 1,4-dimethylpiperazine;N-piperidin-4-ylformamide |
| SMILES | CN1CCN(C)CC1.O=CNC1CCNCC1 |
| InChI | InChI=1S/C6H12N2O.C6H14N2/c9-5-8-6-1-3-7-4-2-6;1-7-3-5-8(2)6-4-7/h5-7H,1-4H2,(H,8,9);3-6H2,1-2H3 |
| InChIKey | CVFNTZQITZOXMY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|