C19H38F2N4O — CID 154671520
N-[3,3-difluoro-1-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]formamide;2-methylpropane (PubChem CID 154671520) has the molecular formula C19H38F2N4O and a molecular weight of 376.54 g/mol. Its IUPAC name is N-[3,3-difluoro-1-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]formamide;2-methylpropane.
| Compound Name | N-[3,3-difluoro-1-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]formamide;2-methylpropane |
|---|---|
| PubChem CID | 154671520 |
| Molecular Formula | C19H38F2N4O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | N-[3,3-difluoro-1-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]formamide;2-methylpropane |
| SMILES | CC(C)C.CC(C)N1CCN(CCN2CCC(NC=O)C(F)(F)C2)CC1 |
| InChI | InChI=1S/C15H28F2N4O.C4H10/c1-13(2)21-9-7-19(8-10-21)5-6-20-4-3-14(18-12-22)15(16,17)11-20;1-4(2)3/h12-14H,3-11H2,1-2H3,(H,18,22);4H,1-3H3 |
| InChIKey | CJVBAHKYWYYINY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|