C13H23F3N4O — CID 151450971
4-(methylamino)-4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)piperidine-1-carbaldehyde (PubChem CID 151450971) has the molecular formula C13H23F3N4O and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-(methylamino)-4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)piperidine-1-carbaldehyde.
| Compound Name | 4-(methylamino)-4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 151450971 |
| Molecular Formula | C13H23F3N4O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-(methylamino)-4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)piperidine-1-carbaldehyde |
| SMILES | CNC1(N2CCN(C)CC2)CCN(C=O)CC1C(F)(F)F |
| InChI | InChI=1S/C13H23F3N4O/c1-17-12(20-7-5-18(2)6-8-20)3-4-19(10-21)9-11(12)13(14,15)16/h10-11,17H,3-9H2,1-2H3 |
| InChIKey | PGMFPALVIYUZAW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|