C18H37F2N3O — CID 176558302
4-(4-butylpiperazin-1-yl)-3,3-difluoropiperidine-1-carbaldehyde;ethane (PubChem CID 176558302) has the molecular formula C18H37F2N3O and a molecular weight of 349.51 g/mol. Its IUPAC name is 4-(4-butylpiperazin-1-yl)-3,3-difluoropiperidine-1-carbaldehyde;ethane.
| Compound Name | 4-(4-butylpiperazin-1-yl)-3,3-difluoropiperidine-1-carbaldehyde;ethane |
|---|---|
| PubChem CID | 176558302 |
| Molecular Formula | C18H37F2N3O |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.29 |
| IUPAC Name | 4-(4-butylpiperazin-1-yl)-3,3-difluoropiperidine-1-carbaldehyde;ethane |
| SMILES | CC.CC.CCCCN1CCN(C2CCN(C=O)CC2(F)F)CC1 |
| InChI | InChI=1S/C14H25F2N3O.2C2H6/c1-2-3-5-17-7-9-19(10-8-17)13-4-6-18(12-20)11-14(13,15)16;2*1-2/h12-13H,2-11H2,1H3;2*1-2H3 |
| InChIKey | NSRBXJFRJQJNCX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|