C12H21F2N3O — CID 166115350
1-(2,2-difluoroethyl)-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 166115350) has the molecular formula C12H21F2N3O and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | 1-(2,2-difluoroethyl)-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 166115350 |
| Molecular Formula | C12H21F2N3O |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CN1CCN(CC(F)F)C2(CCN(C=O)CC2)C1 |
| InChI | InChI=1S/C12H21F2N3O/c1-15-6-7-17(8-11(13)14)12(9-15)2-4-16(10-18)5-3-12/h10-11H,2-9H2,1H3 |
| InChIKey | WEOJGDCJHGLXMU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|