C14H27F2N3O — CID 145233597
3,3-difluoropiperidine-1-carbaldehyde;1-methyl-4-propan-2-ylpiperazine (PubChem CID 145233597) has the molecular formula C14H27F2N3O and a molecular weight of 291.39 g/mol. Its IUPAC name is 3,3-difluoropiperidine-1-carbaldehyde;1-methyl-4-propan-2-ylpiperazine.
| Compound Name | 3,3-difluoropiperidine-1-carbaldehyde;1-methyl-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 145233597 |
| Molecular Formula | C14H27F2N3O |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 3,3-difluoropiperidine-1-carbaldehyde;1-methyl-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C)CC1.O=CN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C8H18N2.C6H9F2NO/c1-8(2)10-6-4-9(3)5-7-10;7-6(8)2-1-3-9(4-6)5-10/h8H,4-7H2,1-3H3;5H,1-4H2 |
| InChIKey | GJCUWPVZAKZAHR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|