C11H21F3N2O — CID 144814248
N-[(2S)-1-[ethyl(2,2,2-trifluoroethyl)amino]pentan-2-yl]-N-methylformamide (PubChem CID 144814248) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is N-[(2S)-1-[ethyl(2,2,2-trifluoroethyl)amino]pentan-2-yl]-N-methylformamide.
| Compound Name | N-[(2S)-1-[ethyl(2,2,2-trifluoroethyl)amino]pentan-2-yl]-N-methylformamide |
|---|---|
| PubChem CID | 144814248 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[(2S)-1-[ethyl(2,2,2-trifluoroethyl)amino]pentan-2-yl]-N-methylformamide |
| SMILES | CCC[C@@H](CN(CC)CC(F)(F)F)N(C)C=O |
| InChI | InChI=1S/C11H21F3N2O/c1-4-6-10(15(3)9-17)7-16(5-2)8-11(12,13)14/h9-10H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | BYOZSTQBVHTWPN-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|