C16H31F3N4O — CID 166115517
ethane;N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide (PubChem CID 166115517) has the molecular formula C16H31F3N4O and a molecular weight of 352.45 g/mol. Its IUPAC name is ethane;N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | ethane;N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 166115517 |
| Molecular Formula | C16H31F3N4O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethane;N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
| SMILES | CC.CN1CCN(CC(F)(F)F)C2(CCN(C(=O)N(C)C)CC2)C1 |
| InChI | InChI=1S/C14H25F3N4O.C2H6/c1-18(2)12(22)20-6-4-13(5-7-20)10-19(3)8-9-21(13)11-14(15,16)17;1-2/h4-11H2,1-3H3;1-2H3 |
| InChIKey | OEBPYSBYCJVNMI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |