C16H23NO2 — CID 143012003
(2S)-4-(2-ethenylhexa-3,5-dienyl)-1-propanoylpyrrolidine-2-carbaldehyde (PubChem CID 143012003) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (2S)-4-(2-ethenylhexa-3,5-dienyl)-1-propanoylpyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-4-(2-ethenylhexa-3,5-dienyl)-1-propanoylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 143012003 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2S)-4-(2-ethenylhexa-3,5-dienyl)-1-propanoylpyrrolidine-2-carbaldehyde |
| SMILES | C=CC=CC(C=C)CC1C[C@@H](C=O)N(C(=O)CC)C1 |
| InChI | InChI=1S/C16H23NO2/c1-4-7-8-13(5-2)9-14-10-15(12-18)17(11-14)16(19)6-3/h4-5,7-8,12-15H,1-2,6,9-11H2,3H3/t13?,14?,15-/m0/s1 |
| InChIKey | GJRVDSHFGVRVKB-NRXISQOPSA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|