C13H19NO2 — CID 178086243
(3S,8Z,10aR)-7,7-dimethyl-5-oxo-1,2,3,6,10,10a-hexahydropyrrolo[1,2-a]azocine-3-carbaldehyde (PubChem CID 178086243) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S,8Z,10aR)-7,7-dimethyl-5-oxo-1,2,3,6,10,10a-hexahydropyrrolo[1,2-a]azocine-3-carbaldehyde.
| Compound Name | (3S,8Z,10aR)-7,7-dimethyl-5-oxo-1,2,3,6,10,10a-hexahydropyrrolo[1,2-a]azocine-3-carbaldehyde |
|---|---|
| PubChem CID | 178086243 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3S,8Z,10aR)-7,7-dimethyl-5-oxo-1,2,3,6,10,10a-hexahydropyrrolo[1,2-a]azocine-3-carbaldehyde |
| SMILES | CC1(C)/C=C\C[C@H]2CC[C@@H](C=O)N2C(=O)C1 |
| InChI | InChI=1S/C13H19NO2/c1-13(2)7-3-4-10-5-6-11(9-15)14(10)12(16)8-13/h3,7,9-11H,4-6,8H2,1-2H3/b7-3-/t10-,11-/m0/s1 |
| InChIKey | ZTANBYKMGISFIJ-BLWKVAPGSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|