C10H19NO3 — CID 143012313
ethane;1-ethyl-4-hydroxy-4-methylpiperidine-2,6-dione (PubChem CID 143012313) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is ethane;1-ethyl-4-hydroxy-4-methylpiperidine-2,6-dione.
| Compound Name | ethane;1-ethyl-4-hydroxy-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 143012313 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethane;1-ethyl-4-hydroxy-4-methylpiperidine-2,6-dione |
| SMILES | CC.CCN1C(=O)CC(C)(O)CC1=O |
| InChI | InChI=1S/C8H13NO3.C2H6/c1-3-9-6(10)4-8(2,12)5-7(9)11;1-2/h12H,3-5H2,1-2H3;1-2H3 |
| InChIKey | RYLDHYLALRHUGA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|