C16H20N4O3 — CID 143012505
(Z)-3-[4-amino-7-[(3S,5S)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enal (PubChem CID 143012505) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (Z)-3-[4-amino-7-[(3S,5S)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enal.
| Compound Name | (Z)-3-[4-amino-7-[(3S,5S)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enal |
|---|---|
| PubChem CID | 143012505 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (Z)-3-[4-amino-7-[(3S,5S)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enal |
| SMILES | C/C(=C/C=O)c1cn(C2O[C@H](CO)C[C@@H]2C)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H20N4O3/c1-9(3-4-21)12-6-20(15-13(12)14(17)18-8-19-15)16-10(2)5-11(7-22)23-16/h3-4,6,8,10-11,16,22H,5,7H2,1-2H3,(H2,17,18,19)/b9-3-/t10-,11-,16?/m0/s1 |
| InChIKey | QMWGVVDEQJHACE-MCDRUWBRSA-N |
| XLogP | 1.53 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|