C8H15N — CID 143012826
ethane;(2Z)-3-methylpenta-2,4-dien-1-imine (PubChem CID 143012826) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is ethane;(2Z)-3-methylpenta-2,4-dien-1-imine.
| Compound Name | ethane;(2Z)-3-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143012826 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | ethane;(2Z)-3-methylpenta-2,4-dien-1-imine |
| SMILES | CC.[H]/N=C/C=C(/C)C=C |
| InChI | InChI=1S/C6H9N.C2H6/c1-3-6(2)4-5-7;1-2/h3-5,7H,1H2,2H3;1-2H3/b6-4-,7-5+; |
| InChIKey | AEUCYJYMYMUYKX-ZMVRXXEHSA-N |
| XLogP | 2.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|