C15H22N2O2 — CID 143013806
N,N-dimethylethenamine;N-ethyl-N-(3-formylphenyl)acetamide (PubChem CID 143013806) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N,N-dimethylethenamine;N-ethyl-N-(3-formylphenyl)acetamide.
| Compound Name | N,N-dimethylethenamine;N-ethyl-N-(3-formylphenyl)acetamide |
|---|---|
| PubChem CID | 143013806 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N,N-dimethylethenamine;N-ethyl-N-(3-formylphenyl)acetamide |
| SMILES | C=CN(C)C.CCN(C(C)=O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C11H13NO2.C4H9N/c1-3-12(9(2)14)11-6-4-5-10(7-11)8-13;1-4-5(2)3/h4-8H,3H2,1-2H3;4H,1H2,2-3H3 |
| InChIKey | IXNWGZAWIRXUKW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|