C9H14N2 — CID 143015883
(6Z)-2,5,7-trimethyl-2,5-dihydro-1,4-diazocine (PubChem CID 143015883) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (6Z)-2,5,7-trimethyl-2,5-dihydro-1,4-diazocine.
| Compound Name | (6Z)-2,5,7-trimethyl-2,5-dihydro-1,4-diazocine |
|---|---|
| PubChem CID | 143015883 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (6Z)-2,5,7-trimethyl-2,5-dihydro-1,4-diazocine |
| SMILES | CC1=C/C(C)/N=C\C(C)/N=C\1 |
| InChI | InChI=1S/C9H14N2/c1-7-4-8(2)11-6-9(3)10-5-7/h4-6,8-9H,1-3H3/b7-4-,10-5-,11-6- |
| InChIKey | UEERFNUFUAVIPC-VHBNHEOMSA-N |
| XLogP | 1.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |