C18H30N2O — CID 143016662
4-(N-ethyl-3,4-dipropylanilino)butanamide (PubChem CID 143016662) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-(N-ethyl-3,4-dipropylanilino)butanamide.
| Compound Name | 4-(N-ethyl-3,4-dipropylanilino)butanamide |
|---|---|
| PubChem CID | 143016662 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 4-(N-ethyl-3,4-dipropylanilino)butanamide |
| SMILES | CCCc1ccc(N(CC)CCCC(N)=O)cc1CCC |
| InChI | InChI=1S/C18H30N2O/c1-4-8-15-11-12-17(14-16(15)9-5-2)20(6-3)13-7-10-18(19)21/h11-12,14H,4-10,13H2,1-3H3,(H2,19,21) |
| InChIKey | MGFLXMHDBPCJPH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|