C18H25N5O4 — CID 123191277
N'-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]butanediamide (PubChem CID 123191277) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is N'-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]butanediamide.
| Compound Name | N'-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]butanediamide |
|---|---|
| PubChem CID | 123191277 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N'-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]butanediamide |
| SMILES | CCN(CCCCNC(=O)CCC(N)=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C18H25N5O4/c1-2-23(10-4-3-9-20-16(25)8-7-15(19)24)12-5-6-13-14(11-12)18(27)22-21-17(13)26/h5-6,11H,2-4,7-10H2,1H3,(H2,19,24)(H,20,25)(H,21,26)(H,22,27) |
| InChIKey | GMGWTTGWDNSHFP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|