C21H31N3O4 — CID 167146206
3-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]-N-[3-[hydroxy(methyl)amino]propyl]propanamide (PubChem CID 167146206) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]-N-[3-[hydroxy(methyl)amino]propyl]propanamide.
| Compound Name | 3-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]-N-[3-[hydroxy(methyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 167146206 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 3-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]-N-[3-[hydroxy(methyl)amino]propyl]propanamide |
| SMILES | CCN(CC)c1ccc2c(C)c(CCC(=O)NCCCN(C)O)c(=O)oc2c1 |
| InChI | InChI=1S/C21H31N3O4/c1-5-24(6-2)16-8-9-17-15(3)18(21(26)28-19(17)14-16)10-11-20(25)22-12-7-13-23(4)27/h8-9,14,27H,5-7,10-13H2,1-4H3,(H,22,25) |
| InChIKey | VEDCGGVIXWZDIP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|