C27H33N3O5 — CID 164804539
2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(dimethylcarbamoyl)phenyl]methyl]carbamate (PubChem CID 164804539) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(dimethylcarbamoyl)phenyl]methyl]carbamate.
| Compound Name | 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(dimethylcarbamoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 164804539 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(dimethylcarbamoyl)phenyl]methyl]carbamate |
| SMILES | CCN(CC)c1ccc2c(C)c(CCOC(=O)NCc3cccc(C(=O)N(C)C)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H33N3O5/c1-6-30(7-2)21-11-12-22-18(3)23(26(32)35-24(22)16-21)13-14-34-27(33)28-17-19-9-8-10-20(15-19)25(31)29(4)5/h8-12,15-16H,6-7,13-14,17H2,1-5H3,(H,28,33) |
| InChIKey | KCCSFRQNJNXSKU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|