C27H30N4O4 — CID 164804556
2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(1H-pyrazol-4-yl)phenyl]methyl]carbamate (PubChem CID 164804556) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(1H-pyrazol-4-yl)phenyl]methyl]carbamate.
| Compound Name | 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(1H-pyrazol-4-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 164804556 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl N-[[3-(1H-pyrazol-4-yl)phenyl]methyl]carbamate |
| SMILES | CCN(CC)c1ccc2c(C)c(CCOC(=O)NCc3cccc(-c4cn[nH]c4)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H30N4O4/c1-4-31(5-2)22-9-10-23-18(3)24(26(32)35-25(23)14-22)11-12-34-27(33)28-15-19-7-6-8-20(13-19)21-16-29-30-17-21/h6-10,13-14,16-17H,4-5,11-12,15H2,1-3H3,(H,28,33)(H,29,30) |
| InChIKey | ZAJHGVIIZBLSLU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|