C26H30FNO3 — CID 165031308
7-(diethylamino)-3-[6-(2-fluorophenyl)-3-oxohexyl]-4-methylchromen-2-one (PubChem CID 165031308) has the molecular formula C26H30FNO3 and a molecular weight of 423.53 g/mol. Its IUPAC name is 7-(diethylamino)-3-[6-(2-fluorophenyl)-3-oxohexyl]-4-methylchromen-2-one.
| Compound Name | 7-(diethylamino)-3-[6-(2-fluorophenyl)-3-oxohexyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 165031308 |
| Molecular Formula | C26H30FNO3 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 7-(diethylamino)-3-[6-(2-fluorophenyl)-3-oxohexyl]-4-methylchromen-2-one |
| SMILES | CCN(CC)c1ccc2c(C)c(CCC(=O)CCCc3ccccc3F)c(=O)oc2c1 |
| InChI | InChI=1S/C26H30FNO3/c1-4-28(5-2)20-13-15-22-18(3)23(26(30)31-25(22)17-20)16-14-21(29)11-8-10-19-9-6-7-12-24(19)27/h6-7,9,12-13,15,17H,4-5,8,10-11,14,16H2,1-3H3 |
| InChIKey | MRSZAJWCQZNRHG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|