C27H33N3O6 — CID 155169603
methyl 2-[3-[[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethylcarbamoylamino]methyl]phenoxy]acetate (PubChem CID 155169603) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is methyl 2-[3-[[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethylcarbamoylamino]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethylcarbamoylamino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 155169603 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl 2-[3-[[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethylcarbamoylamino]methyl]phenoxy]acetate |
| SMILES | CCN(CC)c1ccc2c(C)c(CCNC(=O)NCc3cccc(OCC(=O)OC)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H33N3O6/c1-5-30(6-2)20-10-11-22-18(3)23(26(32)36-24(22)15-20)12-13-28-27(33)29-16-19-8-7-9-21(14-19)35-17-25(31)34-4/h7-11,14-15H,5-6,12-13,16-17H2,1-4H3,(H2,28,29,33) |
| InChIKey | JSWPHOTUCRBMPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|