C28H34N2O6 — CID 164804467
methyl 3-[3-[[3-[7-(diethylamino)-2-oxochromen-4-yl]propoxycarbonylamino]methyl]phenyl]propanoate (PubChem CID 164804467) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is methyl 3-[3-[[3-[7-(diethylamino)-2-oxochromen-4-yl]propoxycarbonylamino]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[[3-[7-(diethylamino)-2-oxochromen-4-yl]propoxycarbonylamino]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 164804467 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | methyl 3-[3-[[3-[7-(diethylamino)-2-oxochromen-4-yl]propoxycarbonylamino]methyl]phenyl]propanoate |
| SMILES | CCN(CC)c1ccc2c(CCCOC(=O)NCc3cccc(CCC(=O)OC)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C28H34N2O6/c1-4-30(5-2)23-12-13-24-22(17-27(32)36-25(24)18-23)10-7-15-35-28(33)29-19-21-9-6-8-20(16-21)11-14-26(31)34-3/h6,8-9,12-13,16-18H,4-5,7,10-11,14-15,19H2,1-3H3,(H,29,33) |
| InChIKey | BATRDFOEJHOBPI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|