C24H27N3O4 — CID 71665698
N-[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]ethyl]-3-phenylpropanamide (PubChem CID 71665698) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 71665698 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]ethyl]-3-phenylpropanamide |
| SMILES | CN(C)c1ccc2c(CC(=O)NCCNC(=O)CCc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H27N3O4/c1-27(2)19-9-10-20-18(15-24(30)31-21(20)16-19)14-23(29)26-13-12-25-22(28)11-8-17-6-4-3-5-7-17/h3-7,9-10,15-16H,8,11-14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | QPBBELPYOFPOBY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|