About 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane
7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane (PubChem CID 160633927) has the molecular formula C17H22INO3
and a molecular weight of 415.27 g/mol. Its IUPAC name is 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane.
Molecular Properties
| Compound Name | 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane |
| PubChem CID | 160633927 |
| Molecular Formula | C17H22INO3 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane |
| SMILES | CC(=O)Cc1cc(=O)oc2cc(N(C)C)ccc12.CC(C)I |
| InChI | InChI=1S/C14H15NO3.C3H7I/c1-9(16)6-10-7-14(17)18-13-8-11(15(2)3)4-5-12(10)13;1-3(2)4/h4-5,7-8H,6H2,1-3H3;3H,1-2H3 |
| InChIKey | RIGZXSGWRGNEEH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane?
The IUPAC name of 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane (CID 160633927) is 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane.
What is the SMILES notation for 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane?
The canonical SMILES for 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane is CC(=O)Cc1cc(=O)oc2cc(N(C)C)ccc12.CC(C)I.
What is the InChIKey of 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane?
The InChIKey is RIGZXSGWRGNEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3.C3H7I/c1-9(16)6-10-7-14(17)18-13-8-11(15(2)3)4-5-12(10)13;1-3(2)4/h4-5,7-8H,6H2,1-3H3;3H,1-2H3.
What are the key properties of 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane?
7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane has a molecular weight of 415.27 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)-4-(2-oxopropyl)chromen-2-one;2-iodopropane is sourced from PubChem (CID 160633927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).