C22H30N4O5 — CID 89378065
(2R)-2-[[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]acetyl]-methylamino]-4-methylpentanamide (PubChem CID 89378065) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is (2R)-2-[[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]acetyl]-methylamino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]acetyl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 89378065 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R)-2-[[2-[[2-[7-(dimethylamino)-2-oxochromen-4-yl]acetyl]amino]acetyl]-methylamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C(N)=O)N(C)C(=O)CNC(=O)Cc1cc(=O)oc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C22H30N4O5/c1-13(2)8-17(22(23)30)26(5)20(28)12-24-19(27)9-14-10-21(29)31-18-11-15(25(3)4)6-7-16(14)18/h6-7,10-11,13,17H,8-9,12H2,1-5H3,(H2,23,30)(H,24,27)/t17-/m1/s1 |
| InChIKey | QOHJKVCLENZWOQ-QGZVFWFLSA-N |
| XLogP | 0.88 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|