C27H30ClNO6 — CID 3501039
(4-butyl-6-chloro-2-oxochromen-7-yl) 6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 3501039) has the molecular formula C27H30ClNO6 and a molecular weight of 499.99 g/mol. Its IUPAC name is (4-butyl-6-chloro-2-oxochromen-7-yl) 6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | (4-butyl-6-chloro-2-oxochromen-7-yl) 6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 3501039 |
| Molecular Formula | C27H30ClNO6 |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (4-butyl-6-chloro-2-oxochromen-7-yl) 6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCc1cc(=O)oc2cc(OC(=O)CCCCCNC(=O)OCc3ccccc3)c(Cl)cc12 |
| InChI | InChI=1S/C27H30ClNO6/c1-2-3-12-20-15-26(31)34-23-17-24(22(28)16-21(20)23)35-25(30)13-8-5-9-14-29-27(32)33-18-19-10-6-4-7-11-19/h4,6-7,10-11,15-17H,2-3,5,8-9,12-14,18H2,1H3,(H,29,32) |
| InChIKey | GQXFSTDAOBPQGH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|