C25H31N3O6 — CID 175212649
amino 3-[[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethoxycarbonylamino]methyl]benzoate (PubChem CID 175212649) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is amino 3-[[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethoxycarbonylamino]methyl]benzoate.
| Compound Name | amino 3-[[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethoxycarbonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 175212649 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | amino 3-[[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethoxycarbonylamino]methyl]benzoate |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)C(CCOC(=O)NCc1cccc(C(=O)ON)c1)C2C |
| InChI | InChI=1S/C25H31N3O6/c1-4-28(5-2)19-9-10-20-16(3)21(24(30)33-22(20)14-19)11-12-32-25(31)27-15-17-7-6-8-18(13-17)23(29)34-26/h6-10,13-14,16,21H,4-5,11-12,15,26H2,1-3H3,(H,27,31) |
| InChIKey | OJJMJKKNMUUVEN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|