C30H35N3O3 — CID 175210329
1-[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl]-3-[(4-phenylphenyl)methyl]urea (PubChem CID 175210329) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl]-3-[(4-phenylphenyl)methyl]urea.
| Compound Name | 1-[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl]-3-[(4-phenylphenyl)methyl]urea |
|---|---|
| PubChem CID | 175210329 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 1-[2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl]-3-[(4-phenylphenyl)methyl]urea |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)C(CCNC(=O)NCc1ccc(-c3ccccc3)cc1)C2C |
| InChI | InChI=1S/C30H35N3O3/c1-4-33(5-2)25-15-16-26-21(3)27(29(34)36-28(26)19-25)17-18-31-30(35)32-20-22-11-13-24(14-12-22)23-9-7-6-8-10-23/h6-16,19,21,27H,4-5,17-18,20H2,1-3H3,(H2,31,32,35) |
| InChIKey | KMDFBQUHAGJPPY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|