C24H31N3O6S — CID 163209079
2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-[(3-sulfamoylphenyl)methyl]carbamate (PubChem CID 163209079) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-[(3-sulfamoylphenyl)methyl]carbamate.
| Compound Name | 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-[(3-sulfamoylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 163209079 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-[(3-sulfamoylphenyl)methyl]carbamate |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)C(CCOC(=O)NCc1cccc(S(N)(=O)=O)c1)C2C |
| InChI | InChI=1S/C24H31N3O6S/c1-4-27(5-2)18-9-10-20-16(3)21(23(28)33-22(20)14-18)11-12-32-24(29)26-15-17-7-6-8-19(13-17)34(25,30)31/h6-10,13-14,16,21H,4-5,11-12,15H2,1-3H3,(H,26,29)(H2,25,30,31) |
| InChIKey | MBZYGAXWLRYISI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|