C25H30N4O4 — CID 175221442
2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-(3H-benzimidazol-5-ylmethyl)carbamate (PubChem CID 175221442) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-(3H-benzimidazol-5-ylmethyl)carbamate.
| Compound Name | 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-(3H-benzimidazol-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 175221442 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[7-(diethylamino)-4-methyl-2-oxo-3,4-dihydrochromen-3-yl]ethyl N-(3H-benzimidazol-5-ylmethyl)carbamate |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)C(CCOC(=O)NCc1ccc3nc[nH]c3c1)C2C |
| InChI | InChI=1S/C25H30N4O4/c1-4-29(5-2)18-7-8-19-16(3)20(24(30)33-23(19)13-18)10-11-32-25(31)26-14-17-6-9-21-22(12-17)28-15-27-21/h6-9,12-13,15-16,20H,4-5,10-11,14H2,1-3H3,(H,26,31)(H,27,28) |
| InChIKey | BLZICZLCZJREFY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|