C28H39N3O2 — CID 143016994
(2S)-2-amino-N-cyclobutyl-N-methyl-2-[4-(methylamino)cyclohexyl]acetamide;2-(3-phenylphenyl)acetaldehyde (PubChem CID 143016994) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclobutyl-N-methyl-2-[4-(methylamino)cyclohexyl]acetamide;2-(3-phenylphenyl)acetaldehyde.
| Compound Name | (2S)-2-amino-N-cyclobutyl-N-methyl-2-[4-(methylamino)cyclohexyl]acetamide;2-(3-phenylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 143016994 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | (2S)-2-amino-N-cyclobutyl-N-methyl-2-[4-(methylamino)cyclohexyl]acetamide;2-(3-phenylphenyl)acetaldehyde |
| SMILES | CNC1CCC([C@H](N)C(=O)N(C)C2CCC2)CC1.O=CCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H27N3O.C14H12O/c1-16-11-8-6-10(7-9-11)13(15)14(18)17(2)12-4-3-5-12;15-10-9-12-5-4-8-14(11-12)13-6-2-1-3-7-13/h10-13,16H,3-9,15H2,1-2H3;1-8,10-11H,9H2/t10?,11?,13-;/m0./s1 |
| InChIKey | UKTXEJCUQXWWPB-XHHYSUMESA-N |
| XLogP | 4.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|