C23H35N3O3 — CID 70338458
N-[4-[(1S)-1-amino-2-[cyclobutyl(methyl)amino]-2-oxoethyl]cyclohexyl]-3-phenylmethoxypropanamide (PubChem CID 70338458) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[4-[(1S)-1-amino-2-[cyclobutyl(methyl)amino]-2-oxoethyl]cyclohexyl]-3-phenylmethoxypropanamide.
| Compound Name | N-[4-[(1S)-1-amino-2-[cyclobutyl(methyl)amino]-2-oxoethyl]cyclohexyl]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 70338458 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | N-[4-[(1S)-1-amino-2-[cyclobutyl(methyl)amino]-2-oxoethyl]cyclohexyl]-3-phenylmethoxypropanamide |
| SMILES | CN(C(=O)[C@@H](N)C1CCC(NC(=O)CCOCc2ccccc2)CC1)C1CCC1 |
| InChI | InChI=1S/C23H35N3O3/c1-26(20-8-5-9-20)23(28)22(24)18-10-12-19(13-11-18)25-21(27)14-15-29-16-17-6-3-2-4-7-17/h2-4,6-7,18-20,22H,5,8-16,24H2,1H3,(H,25,27)/t18?,19?,22-/m0/s1 |
| InChIKey | DIZFDDMHBDKGNI-AJTFCVKESA-N |
| XLogP | 2.61 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|