C20H20BrClN2OS — CID 143018423
2-bromo-2-cyclohepta-1,3,5-trien-1-ylacetaldehyde;5-[(2-chlorophenyl)methyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 143018423) has the molecular formula C20H20BrClN2OS and a molecular weight of 451.82 g/mol. Its IUPAC name is 2-bromo-2-cyclohepta-1,3,5-trien-1-ylacetaldehyde;5-[(2-chlorophenyl)methyl]-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 2-bromo-2-cyclohepta-1,3,5-trien-1-ylacetaldehyde;5-[(2-chlorophenyl)methyl]-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143018423 |
| Molecular Formula | C20H20BrClN2OS |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-bromo-2-cyclohepta-1,3,5-trien-1-ylacetaldehyde;5-[(2-chlorophenyl)methyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1ncc(Cc2ccccc2Cl)s1.O=CC(Br)C1=CC=CC=CC1 |
| InChI | InChI=1S/C11H11ClN2S.C9H9BrO/c1-13-11-14-7-9(15-11)6-8-4-2-3-5-10(8)12;10-9(7-11)8-5-3-1-2-4-6-8/h2-5,7H,6H2,1H3,(H,13,14);1-5,7,9H,6H2 |
| InChIKey | IPQRZJFNMCCEDT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|