C23H30N2O4S — CID 143018517
ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(4-sulfanylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 143018517) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(4-sulfanylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(4-sulfanylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 143018517 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(4-sulfanylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(COCCN)NC2=C(C(=O)CC(C)(C)C2)C1c1ccc(S)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-4-29-22(27)21-17(13-28-10-9-24)25-16-11-23(2,3)12-18(26)20(16)19(21)14-5-7-15(30)8-6-14/h5-8,19,25,30H,4,9-13,24H2,1-3H3 |
| InChIKey | LDWVCUPUDXRJJF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|