C23H33N3O7S — CID 143018515
ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate;methanesulfonic acid (PubChem CID 143018515) has the molecular formula C23H33N3O7S and a molecular weight of 495.60 g/mol. Its IUPAC name is ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate;methanesulfonic acid.
| Compound Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate;methanesulfonic acid |
|---|---|
| PubChem CID | 143018515 |
| Molecular Formula | C23H33N3O7S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate;methanesulfonic acid |
| SMILES | CCOC(=O)C1=C(COCCN)NC2=C(C(=O)CC(C)(C)C2)C1c1cccnc1.CS(=O)(=O)O |
| InChI | InChI=1S/C22H29N3O4.CH4O3S/c1-4-29-21(27)20-16(13-28-9-7-23)25-15-10-22(2,3)11-17(26)19(15)18(20)14-6-5-8-24-12-14;1-5(2,3)4/h5-6,8,12,18,25H,4,7,9-11,13,23H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | YPLSMMIAHNBSCW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 157.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|