C17H28S — CID 143019215
ethane;(4Z)-4-ethylidene-2,2,3-trimethyl-1-benzothiophene (PubChem CID 143019215) has the molecular formula C17H28S and a molecular weight of 264.48 g/mol. Its IUPAC name is ethane;(4Z)-4-ethylidene-2,2,3-trimethyl-1-benzothiophene.
| Compound Name | ethane;(4Z)-4-ethylidene-2,2,3-trimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 143019215 |
| Molecular Formula | C17H28S |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | ethane;(4Z)-4-ethylidene-2,2,3-trimethyl-1-benzothiophene |
| SMILES | C/C=c1/cccc2c1=C(C)C(C)(C)S2.CC.CC |
| InChI | InChI=1S/C13H16S.2C2H6/c1-5-10-7-6-8-11-12(10)9(2)13(3,4)14-11;2*1-2/h5-8H,1-4H3;2*1-2H3/b10-5-;; |
| InChIKey | VXMOHUPXXCOEMJ-KGEBAWAISA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |