C20H23N3O2 — CID 143019450
(E)-N-hydroxy-3-[3-(methylideneamino)-4-[methyl(3-phenylpropyl)amino]phenyl]prop-2-enamide (PubChem CID 143019450) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-(methylideneamino)-4-[methyl(3-phenylpropyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[3-(methylideneamino)-4-[methyl(3-phenylpropyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143019450 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-N-hydroxy-3-[3-(methylideneamino)-4-[methyl(3-phenylpropyl)amino]phenyl]prop-2-enamide |
| SMILES | C=Nc1cc(/C=C/C(=O)NO)ccc1N(C)CCCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-21-18-15-17(11-13-20(24)22-25)10-12-19(18)23(2)14-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-13,15,25H,1,6,9,14H2,2H3,(H,22,24)/b13-11+ |
| InChIKey | GTCKYIVOWUVSFH-ACCUITESSA-N |
| XLogP | 3.61 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|