About 3-N,5-N-dimethylpiperidine-3,5-diamine
3-N,5-N-dimethylpiperidine-3,5-diamine (PubChem CID 143020328) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-N,5-N-dimethylpiperidine-3,5-diamine.
Molecular Properties
| Compound Name | 3-N,5-N-dimethylpiperidine-3,5-diamine |
| PubChem CID | 143020328 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 3-N,5-N-dimethylpiperidine-3,5-diamine |
| SMILES | CNC1CNCC(NC)C1 |
| InChI | InChI=1S/C7H17N3/c1-8-6-3-7(9-2)5-10-4-6/h6-10H,3-5H2,1-2H3 |
| InChIKey | NBMXSNQTOQDIEF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N,5-N-dimethylpiperidine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,5-N-dimethylpiperidine-3,5-diamine?
The IUPAC name of 3-N,5-N-dimethylpiperidine-3,5-diamine (CID 143020328) is 3-N,5-N-dimethylpiperidine-3,5-diamine.
What is the SMILES notation for 3-N,5-N-dimethylpiperidine-3,5-diamine?
The canonical SMILES for 3-N,5-N-dimethylpiperidine-3,5-diamine is CNC1CNCC(NC)C1.
What is the InChIKey of 3-N,5-N-dimethylpiperidine-3,5-diamine?
The InChIKey is NBMXSNQTOQDIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-8-6-3-7(9-2)5-10-4-6/h6-10H,3-5H2,1-2H3.
What are the key properties of 3-N,5-N-dimethylpiperidine-3,5-diamine?
3-N,5-N-dimethylpiperidine-3,5-diamine has a molecular weight of 143.23 g/mol, XLogP of -0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,5-N-dimethylpiperidine-3,5-diamine is sourced from PubChem (CID 143020328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).