C7H17N3 — CID 143020328
3-N,5-N-dimethylpiperidine-3,5-diamine (PubChem CID 143020328) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-N,5-N-dimethylpiperidine-3,5-diamine.
| Compound Name | 3-N,5-N-dimethylpiperidine-3,5-diamine |
|---|---|
| PubChem CID | 143020328 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 3-N,5-N-dimethylpiperidine-3,5-diamine |
| SMILES | CNC1CNCC(NC)C1 |
| InChI | InChI=1S/C7H17N3/c1-8-6-3-7(9-2)5-10-4-6/h6-10H,3-5H2,1-2H3 |
| InChIKey | NBMXSNQTOQDIEF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |