C22H33N4O6SSi+ — CID 143022042
3-[4-[(4-acetamidophenyl)sulfonylamino]-2-nitroanilino]propoxy-tert-butyl-methylsilanylium (PubChem CID 143022042) has the molecular formula C22H33N4O6SSi+ and a molecular weight of 509.68 g/mol. Its IUPAC name is 3-[4-[(4-acetamidophenyl)sulfonylamino]-2-nitroanilino]propoxy-tert-butyl-methylsilanylium.
| Compound Name | 3-[4-[(4-acetamidophenyl)sulfonylamino]-2-nitroanilino]propoxy-tert-butyl-methylsilanylium |
|---|---|
| PubChem CID | 143022042 |
| Molecular Formula | C22H33N4O6SSi+ |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 3-[4-[(4-acetamidophenyl)sulfonylamino]-2-nitroanilino]propoxy-tert-butyl-methylsilanylium |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(NCCCO[SiH2+](C)C(C)(C)C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H33N4O6SSi/c1-16(27)24-17-7-10-19(11-8-17)33(30,31)25-18-9-12-20(21(15-18)26(28)29)23-13-6-14-32-34(5)22(2,3)4/h7-12,15,23,25H,6,13-14,34H2,1-5H3,(H,24,27)/q+1 |
| InChIKey | AJFYZUXAZOAJIN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|