C17H20N4O4S — CID 143022218
N-[4-[4-(3-hydroxypropylamino)-3-nitroanilino]sulfanylphenyl]acetamide (PubChem CID 143022218) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[4-[4-(3-hydroxypropylamino)-3-nitroanilino]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[4-(3-hydroxypropylamino)-3-nitroanilino]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 143022218 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-[4-(3-hydroxypropylamino)-3-nitroanilino]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SNc2ccc(NCCCO)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H20N4O4S/c1-12(23)19-13-3-6-15(7-4-13)26-20-14-5-8-16(18-9-2-10-22)17(11-14)21(24)25/h3-8,11,18,20,22H,2,9-10H2,1H3,(H,19,23) |
| InChIKey | SSTLVSHENRTVNP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|