C22H35N3O — CID 143022132
N-[2-tert-butyl-1-(cyclooctylmethyl)benzimidazol-5-yl]acetamide;molecular hydrogen (PubChem CID 143022132) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is N-[2-tert-butyl-1-(cyclooctylmethyl)benzimidazol-5-yl]acetamide;molecular hydrogen.
| Compound Name | N-[2-tert-butyl-1-(cyclooctylmethyl)benzimidazol-5-yl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 143022132 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | N-[2-tert-butyl-1-(cyclooctylmethyl)benzimidazol-5-yl]acetamide;molecular hydrogen |
| SMILES | CC(=O)Nc1ccc2c(c1)nc(C(C)(C)C)n2CC1CCCCCCC1.[H][H] |
| InChI | InChI=1S/C22H33N3O.H2/c1-16(26)23-18-12-13-20-19(14-18)24-21(22(2,3)4)25(20)15-17-10-8-6-5-7-9-11-17;/h12-14,17H,5-11,15H2,1-4H3,(H,23,26);1H |
| InChIKey | XWZCZOQGQNNXTC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |