C23H30N3O2S+ — CID 162155045
2-tert-butyl-1-(cyclohexylmethyl)-5-(1-hydroxypyridin-1-ium-4-yl)sulfinylbenzimidazole (PubChem CID 162155045) has the molecular formula C23H30N3O2S+ and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-tert-butyl-1-(cyclohexylmethyl)-5-(1-hydroxypyridin-1-ium-4-yl)sulfinylbenzimidazole.
| Compound Name | 2-tert-butyl-1-(cyclohexylmethyl)-5-(1-hydroxypyridin-1-ium-4-yl)sulfinylbenzimidazole |
|---|---|
| PubChem CID | 162155045 |
| Molecular Formula | C23H30N3O2S+ |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-tert-butyl-1-(cyclohexylmethyl)-5-(1-hydroxypyridin-1-ium-4-yl)sulfinylbenzimidazole |
| SMILES | CC(C)(C)c1nc2cc(S(=O)c3cc[n+](O)cc3)ccc2n1CC1CCCCC1 |
| InChI | InChI=1S/C23H30N3O2S/c1-23(2,3)22-24-20-15-19(29(28)18-11-13-25(27)14-12-18)9-10-21(20)26(22)16-17-7-5-4-6-8-17/h9-15,17,27H,4-8,16H2,1-3H3/q+1 |
| InChIKey | ZLSBSPWGKIOEKO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|