C24H37N3O2S — CID 143562037
2-tert-butyl-N-cyclohexyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazole-5-sulfinamide (PubChem CID 143562037) has the molecular formula C24H37N3O2S and a molecular weight of 431.65 g/mol. Its IUPAC name is 2-tert-butyl-N-cyclohexyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazole-5-sulfinamide.
| Compound Name | 2-tert-butyl-N-cyclohexyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazole-5-sulfinamide |
|---|---|
| PubChem CID | 143562037 |
| Molecular Formula | C24H37N3O2S |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-tert-butyl-N-cyclohexyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazole-5-sulfinamide |
| SMILES | CN(C1CCCCC1)S(=O)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C24H37N3O2S/c1-24(2,3)23-25-21-16-20(30(28)26(4)19-8-6-5-7-9-19)10-11-22(21)27(23)17-18-12-14-29-15-13-18/h10-11,16,18-19H,5-9,12-15,17H2,1-4H3 |
| InChIKey | AQXJTMCQRQQDRW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |