C24H39N3OS — CID 143562057
2-tert-butyl-1-(oxan-4-ylmethyl)-5-piperidin-1-ylsulfanylbenzimidazole;ethane (PubChem CID 143562057) has the molecular formula C24H39N3OS and a molecular weight of 417.66 g/mol. Its IUPAC name is 2-tert-butyl-1-(oxan-4-ylmethyl)-5-piperidin-1-ylsulfanylbenzimidazole;ethane.
| Compound Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-5-piperidin-1-ylsulfanylbenzimidazole;ethane |
|---|---|
| PubChem CID | 143562057 |
| Molecular Formula | C24H39N3OS |
| Molecular Weight | 417.66 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-5-piperidin-1-ylsulfanylbenzimidazole;ethane |
| SMILES | CC.CC(C)(C)c1nc2cc(SN3CCCCC3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C22H33N3OS.C2H6/c1-22(2,3)21-23-19-15-18(27-24-11-5-4-6-12-24)7-8-20(19)25(21)16-17-9-13-26-14-10-17;1-2/h7-8,15,17H,4-6,9-14,16H2,1-3H3;1-2H3 |
| InChIKey | ARTKLHJUPJITDH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|