C23H29N3OS — CID 143561900
N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanylaniline (PubChem CID 143561900) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanylaniline.
| Compound Name | N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanylaniline |
|---|---|
| PubChem CID | 143561900 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanylaniline |
| SMILES | CC(C)(C)c1nc2cc(SNc3ccccc3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C23H29N3OS/c1-23(2,3)22-24-20-15-19(28-25-18-7-5-4-6-8-18)9-10-21(20)26(22)16-17-11-13-27-14-12-17/h4-10,15,17,25H,11-14,16H2,1-3H3 |
| InChIKey | ISXZEFPLOUPAGU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|