C22H27N3OS — CID 58010411
2-tert-butyl-1-(oxan-4-ylmethyl)-5-pyridin-3-ylsulfanylbenzimidazole (PubChem CID 58010411) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 2-tert-butyl-1-(oxan-4-ylmethyl)-5-pyridin-3-ylsulfanylbenzimidazole.
| Compound Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-5-pyridin-3-ylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 58010411 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-5-pyridin-3-ylsulfanylbenzimidazole |
| SMILES | CC(C)(C)c1nc2cc(Sc3cccnc3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C22H27N3OS/c1-22(2,3)21-24-19-13-17(27-18-5-4-10-23-14-18)6-7-20(19)25(21)15-16-8-11-26-12-9-16/h4-7,10,13-14,16H,8-9,11-12,15H2,1-3H3 |
| InChIKey | GEKLFUOJFQWSRZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |