C23H28N4O4S — CID 58010534
5-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonylpyridine-3-carboxamide (PubChem CID 58010534) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 5-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonylpyridine-3-carboxamide.
| Compound Name | 5-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58010534 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonylpyridine-3-carboxamide |
| SMILES | CC(C)(C)c1nc2cc(S(=O)(=O)c3cncc(C(N)=O)c3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C23H28N4O4S/c1-23(2,3)22-26-19-11-17(32(29,30)18-10-16(21(24)28)12-25-13-18)4-5-20(19)27(22)14-15-6-8-31-9-7-15/h4-5,10-13,15H,6-9,14H2,1-3H3,(H2,24,28) |
| InChIKey | PHUXLEMPBJMNBG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |