C23H29N3O4S — CID 58010533
4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl-1-methylpyridin-2-one (PubChem CID 58010533) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl-1-methylpyridin-2-one.
| Compound Name | 4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 58010533 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl-1-methylpyridin-2-one |
| SMILES | Cn1ccc(S(=O)(=O)c2ccc3c(c2)nc(C(C)(C)C)n3CC2CCOCC2)cc1=O |
| InChI | InChI=1S/C23H29N3O4S/c1-23(2,3)22-24-19-13-17(31(28,29)18-7-10-25(4)21(27)14-18)5-6-20(19)26(22)15-16-8-11-30-12-9-16/h5-7,10,13-14,16H,8-9,11-12,15H2,1-4H3 |
| InChIKey | RQRZPJJMGGUNJB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |